C7H15NO4S — CID 86078184
2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide (PubChem CID 86078184) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide.
| Compound Name | 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 86078184 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide |
| SMILES | O=C(C(O)CS)N(CCO)CCO |
| InChI | InChI=1S/C7H15NO4S/c9-3-1-8(2-4-10)7(12)6(11)5-13/h6,9-11,13H,1-5H2 |
| InChIKey | QSVFZQHOYWORHN-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|