About 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide
2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide (PubChem CID 86078184) has the molecular formula C7H15NO4S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide |
| PubChem CID | 86078184 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide |
| SMILES | O=C(C(O)CS)N(CCO)CCO |
| InChI | InChI=1S/C7H15NO4S/c9-3-1-8(2-4-10)7(12)6(11)5-13/h6,9-11,13H,1-5H2 |
| InChIKey | QSVFZQHOYWORHN-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide?
The IUPAC name of 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide (CID 86078184) is 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide.
What is the SMILES notation for 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide?
The canonical SMILES for 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide is O=C(C(O)CS)N(CCO)CCO.
What is the InChIKey of 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide?
The InChIKey is QSVFZQHOYWORHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO4S/c9-3-1-8(2-4-10)7(12)6(11)5-13/h6,9-11,13H,1-5H2.
What are the key properties of 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide?
2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide has a molecular weight of 209.27 g/mol, XLogP of -1.91, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,N-bis(2-hydroxyethyl)-3-sulfanylpropanamide is sourced from PubChem (CID 86078184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).