C8H15F2NO2 — CID 103513897
N-butyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide (PubChem CID 103513897) has the molecular formula C8H15F2NO2 and a molecular weight of 195.21 g/mol. Its IUPAC name is N-butyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-butyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 103513897 |
| Molecular Formula | C8H15F2NO2 |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-butyl-2,2-difluoro-N-(2-hydroxyethyl)acetamide |
| SMILES | CCCCN(CCO)C(=O)C(F)F |
| InChI | InChI=1S/C8H15F2NO2/c1-2-3-4-11(5-6-12)8(13)7(9)10/h7,12H,2-6H2,1H3 |
| InChIKey | NOTQCJAAVLNHAX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |