C6H11F2NO2S — CID 107494882
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylacetamide (PubChem CID 107494882) has the molecular formula C6H11F2NO2S and a molecular weight of 199.22 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylacetamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 107494882 |
| Molecular Formula | C6H11F2NO2S |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylacetamide |
| SMILES | O=C(CS)N(CCO)CC(F)F |
| InChI | InChI=1S/C6H11F2NO2S/c7-5(8)3-9(1-2-10)6(11)4-12/h5,10,12H,1-4H2 |
| InChIKey | PICFGGKABSXNRM-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|