C9H14F2N2O2 — CID 107479313
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 107479313) has the molecular formula C9H14F2N2O2 and a molecular weight of 220.22 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 107479313 |
| Molecular Formula | C9H14F2N2O2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C9H14F2N2O2/c1-2-3-12-6-9(15)13(4-5-14)7-8(10)11/h1,8,12,14H,3-7H2 |
| InChIKey | ISYWSRGZBALOKO-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|