About ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate
ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate (PubChem CID 107483466) has the molecular formula C7H13F2NO3
and a molecular weight of 197.18 g/mol. Its IUPAC name is ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate.
Analyze ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate?
The IUPAC name of ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate (CID 107483466) is ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate.
What is the SMILES notation for ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate?
The canonical SMILES for ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate is CCOC(=O)N(CCO)CC(F)F.
What is the InChIKey of ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate?
The InChIKey is UZCKOUHVMPSITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2NO3/c1-2-13-7(12)10(3-4-11)5-6(8)9/h6,11H,2-5H2,1H3.
What are the key properties of ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate?
ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate has a molecular weight of 197.18 g/mol, XLogP of 0.70, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)carbamate is sourced from PubChem (CID 107483466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).