C8H12F2N2O2S — CID 107482755
2-(cyanomethylsulfanyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide (PubChem CID 107482755) has the molecular formula C8H12F2N2O2S and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 107482755 |
| Molecular Formula | C8H12F2N2O2S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)acetamide |
| SMILES | N#CCSCC(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C8H12F2N2O2S/c9-7(10)5-12(2-3-13)8(14)6-15-4-1-11/h7,13H,2-6H2 |
| InChIKey | HUTBIMPYCSDDBH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|