C7H16N4O2 — CID 79163045
3-(3-amino-3-hydroxyiminopropyl)-1-ethyl-1-methylurea (PubChem CID 79163045) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-(3-amino-3-hydroxyiminopropyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(3-amino-3-hydroxyiminopropyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79163045 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-(3-amino-3-hydroxyiminopropyl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)NCCC(N)=NO |
| InChI | InChI=1S/C7H16N4O2/c1-3-11(2)7(12)9-5-4-6(8)10-13/h13H,3-5H2,1-2H3,(H2,8,10)(H,9,12) |
| InChIKey | ALIKMVRPYYHRKU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|