C16H39N7 — CID 161359826
1-ethyl-1,2,3-trimethyl-3-(N,N,N'-trimethylcarbamimidoyl)guanidine;methane;N,N,N'-trimethylethanimidamide (PubChem CID 161359826) has the molecular formula C16H39N7 and a molecular weight of 329.54 g/mol. Its IUPAC name is 1-ethyl-1,2,3-trimethyl-3-(N,N,N'-trimethylcarbamimidoyl)guanidine;methane;N,N,N'-trimethylethanimidamide.
| Compound Name | 1-ethyl-1,2,3-trimethyl-3-(N,N,N'-trimethylcarbamimidoyl)guanidine;methane;N,N,N'-trimethylethanimidamide |
|---|---|
| PubChem CID | 161359826 |
| Molecular Formula | C16H39N7 |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 329.33 |
| IUPAC Name | 1-ethyl-1,2,3-trimethyl-3-(N,N,N'-trimethylcarbamimidoyl)guanidine;methane;N,N,N'-trimethylethanimidamide |
| SMILES | C.C/N=C(\C)N(C)C.CCN(C)/C(=N\C)N(C)/C(=N/C)N(C)C |
| InChI | InChI=1S/C10H23N5.C5H12N2.CH4/c1-8-14(6)10(12-3)15(7)9(11-2)13(4)5;1-5(6-2)7(3)4;/h8H2,1-7H3;1-4H3;1H4/b11-9+,12-10+;6-5+; |
| InChIKey | VPAKQIKMZQBWQK-LIUNACPYSA-N |
| XLogP | 1.64 |
| TPSA | 50.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|