C9H19N3O — CID 118490025
1-ethyl-3-(hydroxymethyl)-1,3-dimethyl-2-[(E)-prop-1-enyl]guanidine (PubChem CID 118490025) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-ethyl-3-(hydroxymethyl)-1,3-dimethyl-2-[(E)-prop-1-enyl]guanidine.
| Compound Name | 1-ethyl-3-(hydroxymethyl)-1,3-dimethyl-2-[(E)-prop-1-enyl]guanidine |
|---|---|
| PubChem CID | 118490025 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-ethyl-3-(hydroxymethyl)-1,3-dimethyl-2-[(E)-prop-1-enyl]guanidine |
| SMILES | C/C=C/N=C(\N(C)CC)N(C)CO |
| InChI | InChI=1S/C9H19N3O/c1-5-7-10-9(11(3)6-2)12(4)8-13/h5,7,13H,6,8H2,1-4H3/b7-5+,10-9+ |
| InChIKey | AWYDNMVKAZDHKA-GLVZAGOZSA-N |
| XLogP | 0.71 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|