C5H12ClN3 — CID 53439431
1-chloro-1,2,3,3-tetramethylguanidine (PubChem CID 53439431) has the molecular formula C5H12ClN3 and a molecular weight of 149.62 g/mol. Its IUPAC name is 1-chloro-1,2,3,3-tetramethylguanidine.
| Compound Name | 1-chloro-1,2,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 53439431 |
| Molecular Formula | C5H12ClN3 |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 1-chloro-1,2,3,3-tetramethylguanidine |
| SMILES | C/N=C(\N(C)C)N(C)Cl |
| InChI | InChI=1S/C5H12ClN3/c1-7-5(8(2)3)9(4)6/h1-4H3/b7-5+ |
| InChIKey | FKHRGSNYQYOEIS-FNORWQNLSA-N |
| XLogP | 0.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|