C5H12CuN3 — CID 59013504
copper(1+);methyl-(N,N,N'-trimethylcarbamimidoyl)azanide (PubChem CID 59013504) has the molecular formula C5H12CuN3 and a molecular weight of 177.72 g/mol. Its IUPAC name is copper(1+);methyl-(N,N,N'-trimethylcarbamimidoyl)azanide.
| Compound Name | copper(1+);methyl-(N,N,N'-trimethylcarbamimidoyl)azanide |
|---|---|
| PubChem CID | 59013504 |
| Molecular Formula | C5H12CuN3 |
| Molecular Weight | 177.72 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | copper(1+);methyl-(N,N,N'-trimethylcarbamimidoyl)azanide |
| SMILES | C/N=C(\[N-]C)N(C)C.[Cu+] |
| InChI | InChI=1S/C5H12N3.Cu/c1-6-5(7-2)8(3)4;/h1-4H3;/q-1;+1 |
| InChIKey | NIKHXFPCPFXUEK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.72 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|