C15H36N9P — CID 91478563
1-bis[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]phosphanyl-1,2,3,3-tetramethylguanidine (PubChem CID 91478563) has the molecular formula C15H36N9P and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-bis[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]phosphanyl-1,2,3,3-tetramethylguanidine.
| Compound Name | 1-bis[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]phosphanyl-1,2,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 91478563 |
| Molecular Formula | C15H36N9P |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 1-bis[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]phosphanyl-1,2,3,3-tetramethylguanidine |
| SMILES | C/N=C(\N(C)C)N(C)P(N(C)/C(=N/C)N(C)C)N(C)/C(=N/C)N(C)C |
| InChI | InChI=1S/C15H36N9P/c1-16-13(19(4)5)22(10)25(23(11)14(17-2)20(6)7)24(12)15(18-3)21(8)9/h1-12H3/b16-13+,17-14+,18-15+ |
| InChIKey | OJKQQVCOCVEWDY-NLCRRHETSA-N |
| XLogP | 0.65 |
| TPSA | 56.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|