About CID 155632794
CID 155632794 (PubChem CID 155632794) has the molecular formula C7H18N3Si
and a molecular weight of 172.33 g/mol.
Molecular Properties
| Compound Name | CID 155632794 |
| PubChem CID | 155632794 |
| Molecular Formula | C7H18N3Si |
| Molecular Weight | 172.33 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | — |
| SMILES | CN(C)C(=N[Si](C)C)N(C)C |
| InChI | InChI=1S/C7H18N3Si/c1-9(2)7(10(3)4)8-11(5)6/h1-6H3 |
| InChIKey | AVRUVEMRAXQWCQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 155632794 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155632794?
The IUPAC name of CID 155632794 (CID 155632794) is not available.
What is the SMILES notation for CID 155632794?
The canonical SMILES for CID 155632794 is CN(C)C(=N[Si](C)C)N(C)C.
What is the InChIKey of CID 155632794?
The InChIKey is AVRUVEMRAXQWCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N3Si/c1-9(2)7(10(3)4)8-11(5)6/h1-6H3.
What are the key properties of CID 155632794?
CID 155632794 has a molecular weight of 172.33 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155632794 is sourced from PubChem (CID 155632794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).