C8H20N3O2P — CID 170393494
2-[dimethoxy(methylidene)-λ5-phosphanyl]-1,1,3,3-tetramethylguanidine (PubChem CID 170393494) has the molecular formula C8H20N3O2P and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-[dimethoxy(methylidene)-λ5-phosphanyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[dimethoxy(methylidene)-λ5-phosphanyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 170393494 |
| Molecular Formula | C8H20N3O2P |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-[dimethoxy(methylidene)-λ5-phosphanyl]-1,1,3,3-tetramethylguanidine |
| SMILES | C=P(N=C(N(C)C)N(C)C)(OC)OC |
| InChI | InChI=1S/C8H20N3O2P/c1-10(2)8(11(3)4)9-14(7,12-5)13-6/h7H2,1-6H3 |
| InChIKey | FBENTBSWIRAKCM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|