C12H28IN3O — CID 111757968
2-(2-methoxy-3,3-dimethylbutyl)-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111757968) has the molecular formula C12H28IN3O and a molecular weight of 357.28 g/mol. Its IUPAC name is 2-(2-methoxy-3,3-dimethylbutyl)-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-(2-methoxy-3,3-dimethylbutyl)-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111757968 |
| Molecular Formula | C12H28IN3O |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(2-methoxy-3,3-dimethylbutyl)-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | COC(CN=C(N(C)C)N(C)C)C(C)(C)C.I |
| InChI | InChI=1S/C12H27N3O.HI/c1-12(2,3)10(16-8)9-13-11(14(4)5)15(6)7;/h10H,9H2,1-8H3;1H |
| InChIKey | ZBRUACKOLYXUIN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|