C9H22N4 — CID 102125400
2-(3-amino-2-methylpropyl)-1,1,3,3-tetramethylguanidine (PubChem CID 102125400) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-(3-amino-2-methylpropyl)-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-(3-amino-2-methylpropyl)-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 102125400 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 2-(3-amino-2-methylpropyl)-1,1,3,3-tetramethylguanidine |
| SMILES | CC(CN)CN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C9H22N4/c1-8(6-10)7-11-9(12(2)3)13(4)5/h8H,6-7,10H2,1-5H3 |
| InChIKey | PCCDYUCFEAABQP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|