C15H26N4 — CID 111056439
1,1,3,3-tetramethyl-2-[2-(N-methylanilino)propyl]guanidine (PubChem CID 111056439) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[2-(N-methylanilino)propyl]guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-[2-(N-methylanilino)propyl]guanidine |
|---|---|
| PubChem CID | 111056439 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[2-(N-methylanilino)propyl]guanidine |
| SMILES | CC(CN=C(N(C)C)N(C)C)N(C)c1ccccc1 |
| InChI | InChI=1S/C15H26N4/c1-13(12-16-15(17(2)3)18(4)5)19(6)14-10-8-7-9-11-14/h7-11,13H,12H2,1-6H3 |
| InChIKey | YFVPNYXWGXRHBQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|