C18H32N4 — CID 111055283
2-[2-(diethylamino)-3-phenylpropyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111055283) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 2-[2-(diethylamino)-3-phenylpropyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[2-(diethylamino)-3-phenylpropyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111055283 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 2-[2-(diethylamino)-3-phenylpropyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CCN(CC)C(CN=C(N(C)C)N(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C18H32N4/c1-7-22(8-2)17(14-16-12-10-9-11-13-16)15-19-18(20(3)4)21(5)6/h9-13,17H,7-8,14-15H2,1-6H3 |
| InChIKey | SPCNHMISKOXROY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|