C21H31IN4O — CID 111055254
2-[2-(diethylamino)-3-phenylpropyl]-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111055254) has the molecular formula C21H31IN4O and a molecular weight of 482.41 g/mol. Its IUPAC name is 2-[2-(diethylamino)-3-phenylpropyl]-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(diethylamino)-3-phenylpropyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111055254 |
| Molecular Formula | C21H31IN4O |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-[2-(diethylamino)-3-phenylpropyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | CCN(CC)C(C/N=C(\N)Nc1cccc(OC)c1)Cc1ccccc1.I |
| InChI | InChI=1S/C21H30N4O.HI/c1-4-25(5-2)19(14-17-10-7-6-8-11-17)16-23-21(22)24-18-12-9-13-20(15-18)26-3;/h6-13,15,19H,4-5,14,16H2,1-3H3,(H3,22,23,24);1H |
| InChIKey | LVRMMSIDHUVUSY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|