C23H54ClN7 — CID 158154876
2-[(2S)-2-amino-4-methylpentyl]-1,1,3,3-tetramethylguanidine;2-[(2S)-2,4-dimethylpentyl]-1,1,3,3-tetramethylguanidine;hydrochloride (PubChem CID 158154876) has the molecular formula C23H54ClN7 and a molecular weight of 464.19 g/mol. Its IUPAC name is 2-[(2S)-2-amino-4-methylpentyl]-1,1,3,3-tetramethylguanidine;2-[(2S)-2,4-dimethylpentyl]-1,1,3,3-tetramethylguanidine;hydrochloride.
| Compound Name | 2-[(2S)-2-amino-4-methylpentyl]-1,1,3,3-tetramethylguanidine;2-[(2S)-2,4-dimethylpentyl]-1,1,3,3-tetramethylguanidine;hydrochloride |
|---|---|
| PubChem CID | 158154876 |
| Molecular Formula | C23H54ClN7 |
| Molecular Weight | 464.19 g/mol |
| Exact Mass | 463.41 |
| IUPAC Name | 2-[(2S)-2-amino-4-methylpentyl]-1,1,3,3-tetramethylguanidine;2-[(2S)-2,4-dimethylpentyl]-1,1,3,3-tetramethylguanidine;hydrochloride |
| SMILES | CC(C)C[C@H](C)CN=C(N(C)C)N(C)C.CC(C)C[C@H](N)CN=C(N(C)C)N(C)C.Cl |
| InChI | InChI=1S/C12H27N3.C11H26N4.ClH/c1-10(2)8-11(3)9-13-12(14(4)5)15(6)7;1-9(2)7-10(12)8-13-11(14(3)4)15(5)6;/h10-11H,8-9H2,1-7H3;9-10H,7-8,12H2,1-6H3;1H/t11-;10-;/m00./s1 |
| InChIKey | DNMHBRGHYXFXMC-KTMNSOIXSA-N |
| XLogP | 3.41 |
| TPSA | 63.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|