C10H23N3O — CID 110032733
1,1,3,3-tetramethyl-2-(2-propan-2-yloxyethyl)guanidine (PubChem CID 110032733) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-propan-2-yloxyethyl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-propan-2-yloxyethyl)guanidine |
|---|---|
| PubChem CID | 110032733 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-propan-2-yloxyethyl)guanidine |
| SMILES | CC(C)OCCN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C10H23N3O/c1-9(2)14-8-7-11-10(12(3)4)13(5)6/h9H,7-8H2,1-6H3 |
| InChIKey | IRGZVCKPFYKTCD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|