C12H27N3 — CID 111813185
1,1,3,3-tetramethyl-2-(5-methylhexyl)guanidine (PubChem CID 111813185) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(5-methylhexyl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(5-methylhexyl)guanidine |
|---|---|
| PubChem CID | 111813185 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(5-methylhexyl)guanidine |
| SMILES | CC(C)CCCCN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C12H27N3/c1-11(2)9-7-8-10-13-12(14(3)4)15(5)6/h11H,7-10H2,1-6H3 |
| InChIKey | ILWBRNXCNIQSSY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|