About 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine
3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine (PubChem CID 170098018) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine.
Molecular Properties
| Compound Name | 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine |
| PubChem CID | 170098018 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine |
| SMILES | CC(C)CCC/N=C(/NO)N(C)C |
| InChI | InChI=1S/C9H21N3O/c1-8(2)6-5-7-10-9(11-13)12(3)4/h8,13H,5-7H2,1-4H3,(H,10,11) |
| InChIKey | GSKIYHPGKOUCOG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine?
The IUPAC name of 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine (CID 170098018) is 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine.
What is the SMILES notation for 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine?
The canonical SMILES for 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine is CC(C)CCC/N=C(/NO)N(C)C.
What is the InChIKey of 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine?
The InChIKey is GSKIYHPGKOUCOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-8(2)6-5-7-10-9(11-13)12(3)4/h8,13H,5-7H2,1-4H3,(H,10,11).
What are the key properties of 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine?
3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine has a molecular weight of 187.29 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine is sourced from PubChem (CID 170098018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).