C9H21N3O — CID 170098018
3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine (PubChem CID 170098018) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine.
| Compound Name | 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine |
|---|---|
| PubChem CID | 170098018 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-hydroxy-1,1-dimethyl-2-(4-methylpentyl)guanidine |
| SMILES | CC(C)CCC/N=C(/NO)N(C)C |
| InChI | InChI=1S/C9H21N3O/c1-8(2)6-5-7-10-9(11-13)12(3)4/h8,13H,5-7H2,1-4H3,(H,10,11) |
| InChIKey | GSKIYHPGKOUCOG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|