C16H33N3O2 — CID 109383330
3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109383330) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109383330 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 3-ethyl-2-(2-methoxy-3,3-dimethylbutyl)-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC(OC)C(C)(C)C)N(C)CC1CCOC1 |
| InChI | InChI=1S/C16H33N3O2/c1-7-17-15(18-10-14(20-6)16(2,3)4)19(5)11-13-8-9-21-12-13/h13-14H,7-12H2,1-6H3,(H,17,18) |
| InChIKey | JMXSEVFATYKDCC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|