C15H30N4O2 — CID 109385439
3-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide (PubChem CID 109385439) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 109385439 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 3-[[ethylamino-[methyl(oxolan-3-ylmethyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(=O)NC)N(C)CC1CCOC1 |
| InChI | InChI=1S/C15H30N4O2/c1-6-17-14(18-11-15(2,3)13(20)16-4)19(5)9-12-7-8-21-10-12/h12H,6-11H2,1-5H3,(H,16,20)(H,17,18) |
| InChIKey | LIFTXMWIIOTYAQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|