C15H31N3O2S — CID 109386781
2-(2-tert-butylsulfinylethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine (PubChem CID 109386781) has the molecular formula C15H31N3O2S and a molecular weight of 317.50 g/mol. Its IUPAC name is 2-(2-tert-butylsulfinylethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2-(2-tert-butylsulfinylethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109386781 |
| Molecular Formula | C15H31N3O2S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-(2-tert-butylsulfinylethyl)-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CCS(=O)C(C)(C)C)N(C)CC1CCOC1 |
| InChI | InChI=1S/C15H31N3O2S/c1-6-16-14(17-8-10-21(19)15(2,3)4)18(5)11-13-7-9-20-12-13/h13H,6-12H2,1-5H3,(H,16,17) |
| InChIKey | DEZANWFSRHFUOH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|