C8H16N4O2S — CID 135083719
methyl N-[bis(dimethylamino)methylidenecarbamothioyl]carbamate (PubChem CID 135083719) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is methyl N-[bis(dimethylamino)methylidenecarbamothioyl]carbamate.
| Compound Name | methyl N-[bis(dimethylamino)methylidenecarbamothioyl]carbamate |
|---|---|
| PubChem CID | 135083719 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | methyl N-[bis(dimethylamino)methylidenecarbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C8H16N4O2S/c1-11(2)7(12(3)4)9-6(15)10-8(13)14-5/h1-5H3,(H,10,13,15) |
| InChIKey | JQUWEIILCRSRHD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|