C16H35IN4O2 — CID 111757918
tert-butyl N-[3-[[bis(dimethylamino)methylideneamino]methyl]pentan-3-yl]carbamate;hydroiodide (PubChem CID 111757918) has the molecular formula C16H35IN4O2 and a molecular weight of 442.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[bis(dimethylamino)methylideneamino]methyl]pentan-3-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[bis(dimethylamino)methylideneamino]methyl]pentan-3-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111757918 |
| Molecular Formula | C16H35IN4O2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | tert-butyl N-[3-[[bis(dimethylamino)methylideneamino]methyl]pentan-3-yl]carbamate;hydroiodide |
| SMILES | CCC(CC)(CN=C(N(C)C)N(C)C)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C16H34N4O2.HI/c1-10-16(11-2,18-14(21)22-15(3,4)5)12-17-13(19(6)7)20(8)9;/h10-12H2,1-9H3,(H,18,21);1H |
| InChIKey | NGHMZMSTOPKUOA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|