C19H38N4O3 — CID 111772206
tert-butyl N-[3-[[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]pentan-3-yl]carbamate (PubChem CID 111772206) has the molecular formula C19H38N4O3 and a molecular weight of 370.54 g/mol. Its IUPAC name is tert-butyl N-[3-[[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 111772206 |
| Molecular Formula | C19H38N4O3 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | tert-butyl N-[3-[[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]pentan-3-yl]carbamate |
| SMILES | CCN/C(=N\CC(CC)(CC)NC(=O)OC(C)(C)C)NCC1CCCO1 |
| InChI | InChI=1S/C19H38N4O3/c1-7-19(8-2,23-17(24)26-18(4,5)6)14-22-16(20-9-3)21-13-15-11-10-12-25-15/h15H,7-14H2,1-6H3,(H,23,24)(H2,20,21,22) |
| InChIKey | AYIPSJFMIZPVCQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|