C13H28N4O3S — CID 111780806
1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111780806) has the molecular formula C13H28N4O3S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111780806 |
| Molecular Formula | C13H28N4O3S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCC1CCCO1 |
| InChI | InChI=1S/C13H28N4O3S/c1-5-14-12(15-9-11-7-6-8-20-11)16-10-13(2,3)17-21(4,18)19/h11,17H,5-10H2,1-4H3,(H2,14,15,16) |
| InChIKey | OMEZZUWIOAZAAN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|