C17H37N5O2S — CID 111786203
1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111786203) has the molecular formula C17H37N5O2S and a molecular weight of 375.58 g/mol. Its IUPAC name is 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111786203 |
| Molecular Formula | C17H37N5O2S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCCCN1CCCCC1C |
| InChI | InChI=1S/C17H37N5O2S/c1-6-18-16(20-14-17(3,4)21-25(5,23)24)19-11-9-13-22-12-8-7-10-15(22)2/h15,21H,6-14H2,1-5H3,(H2,18,19,20) |
| InChIKey | JBUWPGMXQGVIRG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|