C19H37N5O — CID 111370291
N-cyclopropyl-4-[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]butanamide (PubChem CID 111370291) has the molecular formula C19H37N5O and a molecular weight of 351.54 g/mol. Its IUPAC name is N-cyclopropyl-4-[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]butanamide |
|---|---|
| PubChem CID | 111370291 |
| Molecular Formula | C19H37N5O |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | N-cyclopropyl-4-[[ethylamino-[3-(2-methylpiperidin-1-yl)propylamino]methylidene]amino]butanamide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)NCCCN1CCCCC1C |
| InChI | InChI=1S/C19H37N5O/c1-3-20-19(21-12-6-9-18(25)23-17-10-11-17)22-13-7-15-24-14-5-4-8-16(24)2/h16-17H,3-15H2,1-2H3,(H,23,25)(H2,20,21,22) |
| InChIKey | KWEOSHNTHNZVAY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|