C20H39N5O — CID 111324750
3-[[N'-[3-(azepan-1-yl)propyl]-N-ethylcarbamimidoyl]amino]-N-cyclopentylpropanamide (PubChem CID 111324750) has the molecular formula C20H39N5O and a molecular weight of 365.57 g/mol. Its IUPAC name is 3-[[N'-[3-(azepan-1-yl)propyl]-N-ethylcarbamimidoyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 3-[[N'-[3-(azepan-1-yl)propyl]-N-ethylcarbamimidoyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 111324750 |
| Molecular Formula | C20H39N5O |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.32 |
| IUPAC Name | 3-[[N'-[3-(azepan-1-yl)propyl]-N-ethylcarbamimidoyl]amino]-N-cyclopentylpropanamide |
| SMILES | CCN/C(=N\CCCN1CCCCCC1)NCCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H39N5O/c1-2-21-20(22-13-9-17-25-15-7-3-4-8-16-25)23-14-12-19(26)24-18-10-5-6-11-18/h18H,2-17H2,1H3,(H,24,26)(H2,21,22,23) |
| InChIKey | VCDFGFJMVYJDJM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|