C20H42IN5O — CID 111692491
N-cyclopentyl-3-[[N'-[3-[di(propan-2-yl)amino]propyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111692491) has the molecular formula C20H42IN5O and a molecular weight of 495.49 g/mol. Its IUPAC name is N-cyclopentyl-3-[[N'-[3-[di(propan-2-yl)amino]propyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-cyclopentyl-3-[[N'-[3-[di(propan-2-yl)amino]propyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111692491 |
| Molecular Formula | C20H42IN5O |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-cyclopentyl-3-[[N'-[3-[di(propan-2-yl)amino]propyl]-N-ethylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C(C)C)C(C)C)NCCC(=O)NC1CCCC1.I |
| InChI | InChI=1S/C20H41N5O.HI/c1-6-21-20(22-13-9-15-25(16(2)3)17(4)5)23-14-12-19(26)24-18-10-7-8-11-18;/h16-18H,6-15H2,1-5H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | QCNJKKZMEXLPNF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|