C13H27IN4O2 — CID 111136768
3-[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111136768) has the molecular formula C13H27IN4O2 and a molecular weight of 398.29 g/mol. Its IUPAC name is 3-[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111136768 |
| Molecular Formula | C13H27IN4O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-[[ethylamino-(oxolan-2-ylmethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCC1CCCO1.I |
| InChI | InChI=1S/C13H26N4O2.HI/c1-4-15-12(16-8-10-6-5-7-19-10)17-9-13(2,3)11(14)18;/h10H,4-9H2,1-3H3,(H2,14,18)(H2,15,16,17);1H |
| InChIKey | NXTWCLOFSQNEKK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|