C16H33IN4O3 — CID 111407782
3-[[ethylamino-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111407782) has the molecular formula C16H33IN4O3 and a molecular weight of 456.37 g/mol. Its IUPAC name is 3-[[ethylamino-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111407782 |
| Molecular Formula | C16H33IN4O3 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[[ethylamino-[3-(oxolan-2-ylmethoxy)propylamino]methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCCCOCC1CCCO1.I |
| InChI | InChI=1S/C16H32N4O3.HI/c1-4-18-15(20-12-16(2,3)14(17)21)19-8-6-9-22-11-13-7-5-10-23-13;/h13H,4-12H2,1-3H3,(H2,17,21)(H2,18,19,20);1H |
| InChIKey | GQBJKUHDGNVRMF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|