C16H34N4O2 — CID 111757891
tert-butyl N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]pentan-3-yl]carbamate (PubChem CID 111757891) has the molecular formula C16H34N4O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 111757891 |
| Molecular Formula | C16H34N4O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | tert-butyl N-[3-[[[amino-(tert-butylamino)methylidene]amino]methyl]pentan-3-yl]carbamate |
| SMILES | CCC(CC)(C/N=C(\N)NC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H34N4O2/c1-9-16(10-2,20-13(21)22-15(6,7)8)11-18-12(17)19-14(3,4)5/h9-11H2,1-8H3,(H,20,21)(H3,17,18,19) |
| InChIKey | JGUOAWNMHOWNQJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|