C14H30N4O2 — CID 111757731
tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-2-methylpropan-2-yl]carbamate (PubChem CID 111757731) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 111757731 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-2-methylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)N/C(N)=N/CC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30N4O2/c1-12(2,3)17-10(15)16-9-14(7,8)18-11(19)20-13(4,5)6/h9H2,1-8H3,(H,18,19)(H3,15,16,17) |
| InChIKey | HEDUBMUIJYAAIU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|