C15H32N4O2 — CID 111812782
tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate (PubChem CID 111812782) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 111812782 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | tert-butyl N-[1-[[amino-(tert-butylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)C(C/N=C(\N)NC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H32N4O2/c1-10(2)11(18-13(20)21-15(6,7)8)9-17-12(16)19-14(3,4)5/h10-11H,9H2,1-8H3,(H,18,20)(H3,16,17,19) |
| InChIKey | JQVWFPNPWQFHBH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|