C16H34N4O2S — CID 111830847
tert-butyl N-[1-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate (PubChem CID 111830847) has the molecular formula C16H34N4O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is tert-butyl N-[1-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 111830847 |
| Molecular Formula | C16H34N4O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | tert-butyl N-[1-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-3-methylbutan-2-yl]carbamate |
| SMILES | CCN/C(=N\CC(NC(=O)OC(C)(C)C)C(C)C)NCCSC |
| InChI | InChI=1S/C16H34N4O2S/c1-8-17-14(18-9-10-23-7)19-11-13(12(2)3)20-15(21)22-16(4,5)6/h12-13H,8-11H2,1-7H3,(H,20,21)(H2,17,18,19) |
| InChIKey | IPSGXBDYIBCPAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|