C11H25IN4OS — CID 111344172
3-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111344172) has the molecular formula C11H25IN4OS and a molecular weight of 388.32 g/mol. Its IUPAC name is 3-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111344172 |
| Molecular Formula | C11H25IN4OS |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-[[ethylamino-(2-methylsulfanylethylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCCSC.I |
| InChI | InChI=1S/C11H24N4OS.HI/c1-5-13-10(14-6-7-17-4)15-8-11(2,3)9(12)16;/h5-8H2,1-4H3,(H2,12,16)(H2,13,14,15);1H |
| InChIKey | OMONLPZWAJKGEN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|