C11H22N4O — CID 110982887
3-[[ethylamino-(prop-2-enylamino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 110982887) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[[ethylamino-(prop-2-enylamino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-(prop-2-enylamino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110982887 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-[[ethylamino-(prop-2-enylamino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | C=CCN/C(=N/CC(C)(C)C(N)=O)NCC |
| InChI | InChI=1S/C11H22N4O/c1-5-7-14-10(13-6-2)15-8-11(3,4)9(12)16/h5H,1,6-8H2,2-4H3,(H2,12,16)(H2,13,14,15) |
| InChIKey | VEWGEFRNSAGRDD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|