C11H24N4O2 — CID 110942506
3-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 110942506) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110942506 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(C)(C)C(N)=O)NCCOC |
| InChI | InChI=1S/C11H24N4O2/c1-5-13-10(14-6-7-17-4)15-8-11(2,3)9(12)16/h5-8H2,1-4H3,(H2,12,16)(H2,13,14,15) |
| InChIKey | HRRDKBMEWKUXFN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|