C19H32N4O2 — CID 111757923
tert-butyl N-[3-[[[amino-(3-methylanilino)methylidene]amino]methyl]pentan-3-yl]carbamate (PubChem CID 111757923) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[[amino-(3-methylanilino)methylidene]amino]methyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[[amino-(3-methylanilino)methylidene]amino]methyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 111757923 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | tert-butyl N-[3-[[[amino-(3-methylanilino)methylidene]amino]methyl]pentan-3-yl]carbamate |
| SMILES | CCC(CC)(C/N=C(\N)Nc1cccc(C)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N4O2/c1-7-19(8-2,23-17(24)25-18(4,5)6)13-21-16(20)22-15-11-9-10-14(3)12-15/h9-12H,7-8,13H2,1-6H3,(H,23,24)(H3,20,21,22) |
| InChIKey | YGERLCALJJGZEI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|