C18H29N3O2 — CID 111816182
tert-butyl 6-[[amino-(3-methylanilino)methylidene]amino]hexanoate (PubChem CID 111816182) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl 6-[[amino-(3-methylanilino)methylidene]amino]hexanoate.
| Compound Name | tert-butyl 6-[[amino-(3-methylanilino)methylidene]amino]hexanoate |
|---|---|
| PubChem CID | 111816182 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | tert-butyl 6-[[amino-(3-methylanilino)methylidene]amino]hexanoate |
| SMILES | Cc1cccc(N/C(N)=N/CCCCCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H29N3O2/c1-14-9-8-10-15(13-14)21-17(19)20-12-7-5-6-11-16(22)23-18(2,3)4/h8-10,13H,5-7,11-12H2,1-4H3,(H3,19,20,21) |
| InChIKey | IRHHZPKKRDVCFF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|