C15H30N6O2 — CID 177107454
N,N'-bis[bis(dimethylamino)methylidene]pentanediamide (PubChem CID 177107454) has the molecular formula C15H30N6O2 and a molecular weight of 326.45 g/mol. Its IUPAC name is N,N'-bis[bis(dimethylamino)methylidene]pentanediamide.
| Compound Name | N,N'-bis[bis(dimethylamino)methylidene]pentanediamide |
|---|---|
| PubChem CID | 177107454 |
| Molecular Formula | C15H30N6O2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N,N'-bis[bis(dimethylamino)methylidene]pentanediamide |
| SMILES | CN(C)C(=NC(=O)CCCC(=O)N=C(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C15H30N6O2/c1-18(2)14(19(3)4)16-12(22)10-9-11-13(23)17-15(20(5)6)21(7)8/h9-11H2,1-8H3 |
| InChIKey | UXOPZIWVWFMVOY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 71.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|