C13H32BrN5S — CID 21040206
bis(diethylamino)-[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]sulfanium bromide (PubChem CID 21040206) has the molecular formula C13H32BrN5S and a molecular weight of 370.41 g/mol. Its IUPAC name is bis(diethylamino)-[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]sulfanium bromide.
| Compound Name | bis(diethylamino)-[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]sulfanium bromide |
|---|---|
| PubChem CID | 21040206 |
| Molecular Formula | C13H32BrN5S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | bis(diethylamino)-[methyl-(N,N,N'-trimethylcarbamimidoyl)amino]sulfanium bromide |
| SMILES | CCN(CC)[S+](N(CC)CC)N(C)/C(=N/C)N(C)C.[Br-] |
| InChI | InChI=1S/C13H32N5S.BrH/c1-9-17(10-2)19(18(11-3)12-4)16(8)13(14-5)15(6)7;/h9-12H2,1-8H3;1H/q+1;/p-1/b14-13+; |
| InChIKey | SHPPSVKSZVINJG-IERUDJENSA-M |
| XLogP | -1.48 |
| TPSA | 25.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|