C13H27N5 — CID 123479757
N-ethyl-4-methyl-N-(N,N,N'-trimethylcarbamimidoyl)piperidine-1-carboximidamide (PubChem CID 123479757) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-(N,N,N'-trimethylcarbamimidoyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-methyl-N-(N,N,N'-trimethylcarbamimidoyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 123479757 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | N-ethyl-4-methyl-N-(N,N,N'-trimethylcarbamimidoyl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(/N1CCC(C)CC1)N(CC)/C(=N/C)N(C)C |
| InChI | InChI=1S/C13H27N5/c1-6-18(13(15-3)16(4)5)12(14)17-9-7-11(2)8-10-17/h11,14H,6-10H2,1-5H3/b14-12-,15-13+ |
| InChIKey | RDCNMVNPGNNDLK-PMJBJKLVSA-N |
| XLogP | 1.52 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|