C10H20N4O — CID 79163420
N-(2-amino-2-iminoethyl)-N,4-dimethylpiperidine-1-carboxamide (PubChem CID 79163420) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N-(2-amino-2-iminoethyl)-N,4-dimethylpiperidine-1-carboxamide.
| Compound Name | N-(2-amino-2-iminoethyl)-N,4-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79163420 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N-(2-amino-2-iminoethyl)-N,4-dimethylpiperidine-1-carboxamide |
| SMILES | [H]/N=C(\N)CN(C)C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C10H20N4O/c1-8-3-5-14(6-4-8)10(15)13(2)7-9(11)12/h8H,3-7H2,1-2H3,(H3,11,12) |
| InChIKey | CKOXSKOGAZKMNS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|