C9H17N3O4 — CID 67155673
acetic acid;3-(2-amino-2-iminoethyl)pyrrolidine-1-carboxylic acid (PubChem CID 67155673) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is acetic acid;3-(2-amino-2-iminoethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | acetic acid;3-(2-amino-2-iminoethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67155673 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | acetic acid;3-(2-amino-2-iminoethyl)pyrrolidine-1-carboxylic acid |
| SMILES | CC(=O)O.[H]/N=C(\N)CC1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C7H13N3O2.C2H4O2/c8-6(9)3-5-1-2-10(4-5)7(11)12;1-2(3)4/h5H,1-4H2,(H3,8,9)(H,11,12);1H3,(H,3,4) |
| InChIKey | JCVMJCPSIRZCNP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|